C20H32N4O4Si — CID 91741804
ethyl 2-(dimethylamino)-7-methoxy-4-methyl-3-oxo-3a-(trimethylsilylamino)-1H-pyrrolo[3,4-b]indole-8b-carboxylate (PubChem CID 91741804) has the molecular formula C20H32N4O4Si and a molecular weight of 420.59 g/mol. Its IUPAC name is ethyl 2-(dimethylamino)-7-methoxy-4-methyl-3-oxo-3a-(trimethylsilylamino)-1H-pyrrolo[3,4-b]indole-8b-carboxylate.
| Compound Name | ethyl 2-(dimethylamino)-7-methoxy-4-methyl-3-oxo-3a-(trimethylsilylamino)-1H-pyrrolo[3,4-b]indole-8b-carboxylate |
|---|---|
| PubChem CID | 91741804 |
| Molecular Formula | C20H32N4O4Si |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | ethyl 2-(dimethylamino)-7-methoxy-4-methyl-3-oxo-3a-(trimethylsilylamino)-1H-pyrrolo[3,4-b]indole-8b-carboxylate |
| SMILES | CCOC(=O)C12CN(N(C)C)C(=O)C1(N[Si](C)(C)C)N(C)c1ccc(OC)cc12 |
| InChI | InChI=1S/C20H32N4O4Si/c1-9-28-18(26)19-13-24(22(2)3)17(25)20(19,21-29(6,7)8)23(4)16-11-10-14(27-5)12-15(16)19/h10-12,21H,9,13H2,1-8H3 |
| InChIKey | YRJPPFDRSQGBSQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|