C18H21F6NO3 — CID 91742056
butyl 2-[[2,5-bis(trifluoromethyl)benzoyl]amino]-3-methylbutanoate (PubChem CID 91742056) has the molecular formula C18H21F6NO3 and a molecular weight of 413.36 g/mol. Its IUPAC name is butyl 2-[[2,5-bis(trifluoromethyl)benzoyl]amino]-3-methylbutanoate.
| Compound Name | butyl 2-[[2,5-bis(trifluoromethyl)benzoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 91742056 |
| Molecular Formula | C18H21F6NO3 |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | butyl 2-[[2,5-bis(trifluoromethyl)benzoyl]amino]-3-methylbutanoate |
| SMILES | CCCCOC(=O)C(NC(=O)c1cc(C(F)(F)F)ccc1C(F)(F)F)C(C)C |
| InChI | InChI=1S/C18H21F6NO3/c1-4-5-8-28-16(27)14(10(2)3)25-15(26)12-9-11(17(19,20)21)6-7-13(12)18(22,23)24/h6-7,9-10,14H,4-5,8H2,1-3H3,(H,25,26) |
| InChIKey | PAWHMEAFLYPFBO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|