C23H34F8O4 — CID 91742248
4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 1-O-[(E)-tetradec-3-enyl] butanedioate (PubChem CID 91742248) has the molecular formula C23H34F8O4 and a molecular weight of 526.51 g/mol. Its IUPAC name is 4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 1-O-[(E)-tetradec-3-enyl] butanedioate.
| Compound Name | 4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 1-O-[(E)-tetradec-3-enyl] butanedioate |
|---|---|
| PubChem CID | 91742248 |
| Molecular Formula | C23H34F8O4 |
| Molecular Weight | 526.51 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | 4-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 1-O-[(E)-tetradec-3-enyl] butanedioate |
| SMILES | CCCCCCCCCC/C=C/CCOC(=O)CCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C23H34F8O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-34-18(32)14-15-19(33)35-17-21(26,27)23(30,31)22(28,29)20(24)25/h11-12,20H,2-10,13-17H2,1H3/b12-11+ |
| InChIKey | AHOUCQSRVUZQRV-VAWYXSNFSA-N |
| XLogP | 7.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.51 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|