C15H15N5O4 — CID 91742863
ethyl 6-methyl-3-[(4-nitrophenyl)methyl]-5H-pyrazolo[5,1-c][1,2,4]triazole-7-carboxylate (PubChem CID 91742863) has the molecular formula C15H15N5O4 and a molecular weight of 329.32 g/mol. Its IUPAC name is ethyl 6-methyl-3-[(4-nitrophenyl)methyl]-5H-pyrazolo[5,1-c][1,2,4]triazole-7-carboxylate.
| Compound Name | ethyl 6-methyl-3-[(4-nitrophenyl)methyl]-5H-pyrazolo[5,1-c][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 91742863 |
| Molecular Formula | C15H15N5O4 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | ethyl 6-methyl-3-[(4-nitrophenyl)methyl]-5H-pyrazolo[5,1-c][1,2,4]triazole-7-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]n2c(Cc3ccc([N+](=O)[O-])cc3)nnc12 |
| InChI | InChI=1S/C15H15N5O4/c1-3-24-15(21)13-9(2)18-19-12(16-17-14(13)19)8-10-4-6-11(7-5-10)20(22)23/h4-7,18H,3,8H2,1-2H3 |
| InChIKey | PXKFZIPIONBOHK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|