C15H13N3O6 — CID 150445810
6-O-ethyl 2-O-[(4-nitrophenyl)methyl] pyrazine-2,6-dicarboxylate (PubChem CID 150445810) has the molecular formula C15H13N3O6 and a molecular weight of 331.28 g/mol. Its IUPAC name is 6-O-ethyl 2-O-[(4-nitrophenyl)methyl] pyrazine-2,6-dicarboxylate.
| Compound Name | 6-O-ethyl 2-O-[(4-nitrophenyl)methyl] pyrazine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 150445810 |
| Molecular Formula | C15H13N3O6 |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 6-O-ethyl 2-O-[(4-nitrophenyl)methyl] pyrazine-2,6-dicarboxylate |
| SMILES | CCOC(=O)c1cncc(C(=O)OCc2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C15H13N3O6/c1-2-23-14(19)12-7-16-8-13(17-12)15(20)24-9-10-3-5-11(6-4-10)18(21)22/h3-8H,2,9H2,1H3 |
| InChIKey | HMSVELBTWRPSHI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 121.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|