C14H11N5O4 — CID 4850079
(4-nitrophenyl)methyl 5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 4850079) has the molecular formula C14H11N5O4 and a molecular weight of 313.27 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 4850079 |
| Molecular Formula | C14H11N5O4 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | (4-nitrophenyl)methyl 5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | Cc1ccn2nc(C(=O)OCc3ccc([N+](=O)[O-])cc3)nc2n1 |
| InChI | InChI=1S/C14H11N5O4/c1-9-6-7-18-14(15-9)16-12(17-18)13(20)23-8-10-2-4-11(5-3-10)19(21)22/h2-7H,8H2,1H3 |
| InChIKey | YTBMYYUUSJYZNG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 112.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|