C21H19N3O4S — CID 7805089
(4-nitrophenyl)methyl 2-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoate (PubChem CID 7805089) has the molecular formula C21H19N3O4S and a molecular weight of 409.47 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoate.
| Compound Name | (4-nitrophenyl)methyl 2-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 7805089 |
| Molecular Formula | C21H19N3O4S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoate |
| SMILES | Cc1cc(C)nc(SCc2ccccc2C(=O)OCc2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C21H19N3O4S/c1-14-11-15(2)23-21(22-14)29-13-17-5-3-4-6-19(17)20(25)28-12-16-7-9-18(10-8-16)24(26)27/h3-11H,12-13H2,1-2H3 |
| InChIKey | IRPUPHPLOQSHLU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 95.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|