C17H17F5OSi — CID 91742948
dimethyl-(2,3,4,5,6-pentafluorophenyl)-(1-phenylpropoxy)silane (PubChem CID 91742948) has the molecular formula C17H17F5OSi and a molecular weight of 360.40 g/mol. Its IUPAC name is dimethyl-(2,3,4,5,6-pentafluorophenyl)-(1-phenylpropoxy)silane.
| Compound Name | dimethyl-(2,3,4,5,6-pentafluorophenyl)-(1-phenylpropoxy)silane |
|---|---|
| PubChem CID | 91742948 |
| Molecular Formula | C17H17F5OSi |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | dimethyl-(2,3,4,5,6-pentafluorophenyl)-(1-phenylpropoxy)silane |
| SMILES | CCC(O[Si](C)(C)c1c(F)c(F)c(F)c(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C17H17F5OSi/c1-4-11(10-8-6-5-7-9-10)23-24(2,3)17-15(21)13(19)12(18)14(20)16(17)22/h5-9,11H,4H2,1-3H3 |
| InChIKey | VQLWGSXXSJIXIG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|