C23H17BF10Si — CID 134903522
[2-bis(2,3,4,5,6-pentafluorophenyl)boranyl-2-phenylethyl]-trimethylsilane (PubChem CID 134903522) has the molecular formula C23H17BF10Si and a molecular weight of 522.27 g/mol. Its IUPAC name is [2-bis(2,3,4,5,6-pentafluorophenyl)boranyl-2-phenylethyl]-trimethylsilane.
| Compound Name | [2-bis(2,3,4,5,6-pentafluorophenyl)boranyl-2-phenylethyl]-trimethylsilane |
|---|---|
| PubChem CID | 134903522 |
| Molecular Formula | C23H17BF10Si |
| Molecular Weight | 522.27 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | [2-bis(2,3,4,5,6-pentafluorophenyl)boranyl-2-phenylethyl]-trimethylsilane |
| SMILES | C[Si](C)(C)CC(B(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C23H17BF10Si/c1-35(2,3)9-11(10-7-5-4-6-8-10)24(12-14(25)18(29)22(33)19(30)15(12)26)13-16(27)20(31)23(34)21(32)17(13)28/h4-8,11H,9H2,1-3H3 |
| InChIKey | ZUEXVRVRAHAHTM-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.27 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|