C15H16BrF3O4 — CID 91743288
4-O-(3-bromo-1,1,1-trifluoropropan-2-yl) 1-O-butyl benzene-1,4-dicarboxylate (PubChem CID 91743288) has the molecular formula C15H16BrF3O4 and a molecular weight of 397.19 g/mol. Its IUPAC name is 4-O-(3-bromo-1,1,1-trifluoropropan-2-yl) 1-O-butyl benzene-1,4-dicarboxylate.
| Compound Name | 4-O-(3-bromo-1,1,1-trifluoropropan-2-yl) 1-O-butyl benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 91743288 |
| Molecular Formula | C15H16BrF3O4 |
| Molecular Weight | 397.19 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 4-O-(3-bromo-1,1,1-trifluoropropan-2-yl) 1-O-butyl benzene-1,4-dicarboxylate |
| SMILES | CCCCOC(=O)c1ccc(C(=O)OC(CBr)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H16BrF3O4/c1-2-3-8-22-13(20)10-4-6-11(7-5-10)14(21)23-12(9-16)15(17,18)19/h4-7,12H,2-3,8-9H2,1H3 |
| InChIKey | UAVCNDLDPICQGY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.19 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|