C19H19N3O4 — CID 91743625
5-methyl-2-phenyl-4-(2,4,6-trimethoxyphenyl)iminopyrazol-3-one (PubChem CID 91743625) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is 5-methyl-2-phenyl-4-(2,4,6-trimethoxyphenyl)iminopyrazol-3-one.
| Compound Name | 5-methyl-2-phenyl-4-(2,4,6-trimethoxyphenyl)iminopyrazol-3-one |
|---|---|
| PubChem CID | 91743625 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 5-methyl-2-phenyl-4-(2,4,6-trimethoxyphenyl)iminopyrazol-3-one |
| SMILES | COc1cc(OC)c(/N=C2/C(=O)N(c3ccccc3)N=C2C)c(OC)c1 |
| InChI | InChI=1S/C19H19N3O4/c1-12-17(19(23)22(21-12)13-8-6-5-7-9-13)20-18-15(25-3)10-14(24-2)11-16(18)26-4/h5-11H,1-4H3/b20-17+ |
| InChIKey | ADMGTMCXSKIJFE-LVZFUZTISA-N |
| XLogP | 3.21 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_fives(89)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|