C17H12Cl2N4O3 — CID 4291581
[(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)amino] N-(3,4-dichlorophenyl)carbamate (PubChem CID 4291581) has the molecular formula C17H12Cl2N4O3 and a molecular weight of 391.21 g/mol. Its IUPAC name is [(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)amino] N-(3,4-dichlorophenyl)carbamate.
| Compound Name | [(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)amino] N-(3,4-dichlorophenyl)carbamate |
|---|---|
| PubChem CID | 4291581 |
| Molecular Formula | C17H12Cl2N4O3 |
| Molecular Weight | 391.21 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | [(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)amino] N-(3,4-dichlorophenyl)carbamate |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1=NOC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H12Cl2N4O3/c1-10-15(16(24)23(21-10)12-5-3-2-4-6-12)22-26-17(25)20-11-7-8-13(18)14(19)9-11/h2-9H,1H3,(H,20,25) |
| InChIKey | STURUUYZPBDENA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.21 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_fives(89)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|