C16H14Cl2N4O — CID 11046301
1-(3,4-dichlorophenyl)-3-(1-phenyl-4,5-dihydroimidazol-2-yl)urea (PubChem CID 11046301) has the molecular formula C16H14Cl2N4O and a molecular weight of 349.22 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(1-phenyl-4,5-dihydroimidazol-2-yl)urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(1-phenyl-4,5-dihydroimidazol-2-yl)urea |
|---|---|
| PubChem CID | 11046301 |
| Molecular Formula | C16H14Cl2N4O |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(1-phenyl-4,5-dihydroimidazol-2-yl)urea |
| SMILES | O=C(NC1=NCCN1c1ccccc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2N4O/c17-13-7-6-11(10-14(13)18)20-16(23)21-15-19-8-9-22(15)12-4-2-1-3-5-12/h1-7,10H,8-9H2,(H2,19,20,21,23) |
| InChIKey | HCBSXYCCLFRRTJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |