C17H14F4N2O2 — CID 91743651
ethyl 3-(2,4-difluoroanilino)-3-(2,4-difluorophenyl)iminopropanoate (PubChem CID 91743651) has the molecular formula C17H14F4N2O2 and a molecular weight of 354.30 g/mol. Its IUPAC name is ethyl 3-(2,4-difluoroanilino)-3-(2,4-difluorophenyl)iminopropanoate.
| Compound Name | ethyl 3-(2,4-difluoroanilino)-3-(2,4-difluorophenyl)iminopropanoate |
|---|---|
| PubChem CID | 91743651 |
| Molecular Formula | C17H14F4N2O2 |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | ethyl 3-(2,4-difluoroanilino)-3-(2,4-difluorophenyl)iminopropanoate |
| SMILES | CCOC(=O)C/C(=N/c1ccc(F)cc1F)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C17H14F4N2O2/c1-2-25-17(24)9-16(22-14-5-3-10(18)7-12(14)20)23-15-6-4-11(19)8-13(15)21/h3-8H,2,9H2,1H3,(H,22,23) |
| InChIKey | XOYVJTQLOVVGLO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|