C24H14B2F4N2O2 — CID 91744380
(6-difluoroboranyloxy-4,5-dipyridin-2-ylphenanthren-3-yl)oxy-difluoroborane (PubChem CID 91744380) has the molecular formula C24H14B2F4N2O2 and a molecular weight of 460.00 g/mol. Its IUPAC name is (6-difluoroboranyloxy-4,5-dipyridin-2-ylphenanthren-3-yl)oxy-difluoroborane.
| Compound Name | (6-difluoroboranyloxy-4,5-dipyridin-2-ylphenanthren-3-yl)oxy-difluoroborane |
|---|---|
| PubChem CID | 91744380 |
| Molecular Formula | C24H14B2F4N2O2 |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | (6-difluoroboranyloxy-4,5-dipyridin-2-ylphenanthren-3-yl)oxy-difluoroborane |
| SMILES | FB(F)Oc1ccc2ccc3ccc(OB(F)F)c(-c4ccccn4)c3c2c1-c1ccccn1 |
| InChI | InChI=1S/C24H14B2F4N2O2/c27-25(28)33-19-11-9-15-7-8-16-10-12-20(34-26(29)30)24(18-6-2-4-14-32-18)22(16)21(15)23(19)17-5-1-3-13-31-17/h1-14H |
| InChIKey | YZQAWRPRNIQAEB-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|