C28H20N2O — CID 91744769
4-[4-(N-phenylanilino)phenyl]iminonaphthalen-1-one (PubChem CID 91744769) has the molecular formula C28H20N2O and a molecular weight of 400.48 g/mol. Its IUPAC name is 4-[4-(N-phenylanilino)phenyl]iminonaphthalen-1-one.
| Compound Name | 4-[4-(N-phenylanilino)phenyl]iminonaphthalen-1-one |
|---|---|
| PubChem CID | 91744769 |
| Molecular Formula | C28H20N2O |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 4-[4-(N-phenylanilino)phenyl]iminonaphthalen-1-one |
| SMILES | O=C1C=C/C(=N\c2ccc(N(c3ccccc3)c3ccccc3)cc2)c2ccccc21 |
| InChI | InChI=1S/C28H20N2O/c31-28-20-19-27(25-13-7-8-14-26(25)28)29-21-15-17-24(18-16-21)30(22-9-3-1-4-10-22)23-11-5-2-6-12-23/h1-20H/b29-27+ |
| InChIKey | KRCFBRWRTTUEPM-ORIPQNMZSA-N |
| XLogP | 7.03 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|