C19H20F15NO3 — CID 91745593
hexyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)pent-4-enoate (PubChem CID 91745593) has the molecular formula C19H20F15NO3 and a molecular weight of 595.34 g/mol. Its IUPAC name is hexyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)pent-4-enoate.
| Compound Name | hexyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)pent-4-enoate |
|---|---|
| PubChem CID | 91745593 |
| Molecular Formula | C19H20F15NO3 |
| Molecular Weight | 595.34 g/mol |
| Exact Mass | 595.12 |
| IUPAC Name | hexyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)pent-4-enoate |
| SMILES | C=CCC(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCCCCCC |
| InChI | InChI=1S/C19H20F15NO3/c1-3-5-6-7-9-38-11(36)10(8-4-2)35-12(37)13(20,21)14(22,23)15(24,25)16(26,27)17(28,29)18(30,31)19(32,33)34/h4,10H,2-3,5-9H2,1H3,(H,35,37) |
| InChIKey | GHRUUFFWYWWSFH-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.34 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|