C23H28F15NO3 — CID 91745601
decyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)pent-4-enoate (PubChem CID 91745601) has the molecular formula C23H28F15NO3 and a molecular weight of 651.45 g/mol. Its IUPAC name is decyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)pent-4-enoate.
| Compound Name | decyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)pent-4-enoate |
|---|---|
| PubChem CID | 91745601 |
| Molecular Formula | C23H28F15NO3 |
| Molecular Weight | 651.45 g/mol |
| Exact Mass | 651.18 |
| IUPAC Name | decyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)pent-4-enoate |
| SMILES | C=CCC(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCCCCCCCCCC |
| InChI | InChI=1S/C23H28F15NO3/c1-3-5-6-7-8-9-10-11-13-42-15(40)14(12-4-2)39-16(41)17(24,25)18(26,27)19(28,29)20(30,31)21(32,33)22(34,35)23(36,37)38/h4,14H,2-3,5-13H2,1H3,(H,39,41) |
| InChIKey | GHVYOLNVGMYPCZ-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.45 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|