C22H26F15NO3 — CID 91745603
nonyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)pent-4-enoate (PubChem CID 91745603) has the molecular formula C22H26F15NO3 and a molecular weight of 637.42 g/mol. Its IUPAC name is nonyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)pent-4-enoate.
| Compound Name | nonyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)pent-4-enoate |
|---|---|
| PubChem CID | 91745603 |
| Molecular Formula | C22H26F15NO3 |
| Molecular Weight | 637.42 g/mol |
| Exact Mass | 637.17 |
| IUPAC Name | nonyl 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)pent-4-enoate |
| SMILES | C=CCC(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCCCCCCCCC |
| InChI | InChI=1S/C22H26F15NO3/c1-3-5-6-7-8-9-10-12-41-14(39)13(11-4-2)38-15(40)16(23,24)17(25,26)18(27,28)19(29,30)20(31,32)21(33,34)22(35,36)37/h4,13H,2-3,5-12H2,1H3,(H,38,40) |
| InChIKey | RSQWZWYKPCFJDK-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.42 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|