C26H18B2F4N2O2 — CID 91745780
(6-difluoroboranyloxy-2,7-dimethyl-4,5-dipyridin-2-ylphenanthren-3-yl)oxy-difluoroborane (PubChem CID 91745780) has the molecular formula C26H18B2F4N2O2 and a molecular weight of 488.06 g/mol. Its IUPAC name is (6-difluoroboranyloxy-2,7-dimethyl-4,5-dipyridin-2-ylphenanthren-3-yl)oxy-difluoroborane.
| Compound Name | (6-difluoroboranyloxy-2,7-dimethyl-4,5-dipyridin-2-ylphenanthren-3-yl)oxy-difluoroborane |
|---|---|
| PubChem CID | 91745780 |
| Molecular Formula | C26H18B2F4N2O2 |
| Molecular Weight | 488.06 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | (6-difluoroboranyloxy-2,7-dimethyl-4,5-dipyridin-2-ylphenanthren-3-yl)oxy-difluoroborane |
| SMILES | Cc1cc2ccc3cc(C)c(OB(F)F)c(-c4ccccn4)c3c2c(-c2ccccn2)c1OB(F)F |
| InChI | InChI=1S/C26H18B2F4N2O2/c1-15-13-17-9-10-18-14-16(2)26(36-28(31)32)24(20-8-4-6-12-34-20)22(18)21(17)23(25(15)35-27(29)30)19-7-3-5-11-33-19/h3-14H,1-2H3 |
| InChIKey | QLIYGEVKVAXGDV-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.06 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|