C23H32O5Si — CID 91747302
methyl (1S,8S,9S,10R,12S)-11-methyl-6-methylidene-16-oxo-12-trimethylsilyloxy-15-oxahexacyclo[9.3.2.15,8.01,10.02,7.02,8]heptadecane-9-carboxylate (PubChem CID 91747302) has the molecular formula C23H32O5Si and a molecular weight of 416.59 g/mol. Its IUPAC name is methyl (1S,8S,9S,10R,12S)-11-methyl-6-methylidene-16-oxo-12-trimethylsilyloxy-15-oxahexacyclo[9.3.2.15,8.01,10.02,7.02,8]heptadecane-9-carboxylate.
| Compound Name | methyl (1S,8S,9S,10R,12S)-11-methyl-6-methylidene-16-oxo-12-trimethylsilyloxy-15-oxahexacyclo[9.3.2.15,8.01,10.02,7.02,8]heptadecane-9-carboxylate |
|---|---|
| PubChem CID | 91747302 |
| Molecular Formula | C23H32O5Si |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | methyl (1S,8S,9S,10R,12S)-11-methyl-6-methylidene-16-oxo-12-trimethylsilyloxy-15-oxahexacyclo[9.3.2.15,8.01,10.02,7.02,8]heptadecane-9-carboxylate |
| SMILES | C=C1C2CCC34C1[C@@]3(C2)[C@@H](C(=O)OC)[C@@H]1C2(C)C(=O)O[C@@]14CC[C@@H]2O[Si](C)(C)C |
| InChI | InChI=1S/C23H32O5Si/c1-12-13-7-9-22-16(12)21(22,11-13)15(18(24)26-3)17-20(2)14(28-29(4,5)6)8-10-23(17,22)27-19(20)25/h13-17H,1,7-11H2,2-6H3/t13?,14-,15+,16?,17+,20?,21+,22?,23-/m0/s1 |
| InChIKey | DJWIPOWTBQNJHO-DOJMVULQSA-N |
| XLogP | 3.69 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|