C23H30O9S — CID 10552805
methyl (1R,5S,8S,9S,11R,12S)-5-acetyloxy-11-methyl-6-methylidene-12-methylsulfonyloxy-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate (PubChem CID 10552805) has the molecular formula C23H30O9S and a molecular weight of 482.55 g/mol. Its IUPAC name is methyl (1R,5S,8S,9S,11R,12S)-5-acetyloxy-11-methyl-6-methylidene-12-methylsulfonyloxy-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate.
| Compound Name | methyl (1R,5S,8S,9S,11R,12S)-5-acetyloxy-11-methyl-6-methylidene-12-methylsulfonyloxy-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate |
|---|---|
| PubChem CID | 10552805 |
| Molecular Formula | C23H30O9S |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | methyl (1R,5S,8S,9S,11R,12S)-5-acetyloxy-11-methyl-6-methylidene-12-methylsulfonyloxy-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate |
| SMILES | C=C1C[C@]23C[C@@]1(OC(C)=O)CCC2[C@@]12CC[C@H](OS(C)(=O)=O)[C@](C)(C(=O)O1)C2C3C(=O)OC |
| InChI | InChI=1S/C23H30O9S/c1-12-10-21-11-22(12,30-13(2)24)8-6-14(21)23-9-7-15(32-33(5,27)28)20(3,19(26)31-23)17(23)16(21)18(25)29-4/h14-17H,1,6-11H2,2-5H3/t14?,15-,16?,17?,20-,21-,22-,23+/m0/s1 |
| InChIKey | NEGYODVECQVKRI-DJGFTDHQSA-N |
| XLogP | 1.89 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|