C24H29BrO9 — CID 10554471
methyl (1R,5S,6S,8R,9S,11S,12R,13R)-5,13-diacetyloxy-12-bromo-11-methyl-16-oxospiro[15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-6,2'-oxirane]-9-carboxylate (PubChem CID 10554471) has the molecular formula C24H29BrO9 and a molecular weight of 541.39 g/mol. Its IUPAC name is methyl (1R,5S,6S,8R,9S,11S,12R,13R)-5,13-diacetyloxy-12-bromo-11-methyl-16-oxospiro[15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-6,2'-oxirane]-9-carboxylate.
| Compound Name | methyl (1R,5S,6S,8R,9S,11S,12R,13R)-5,13-diacetyloxy-12-bromo-11-methyl-16-oxospiro[15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-6,2'-oxirane]-9-carboxylate |
|---|---|
| PubChem CID | 10554471 |
| Molecular Formula | C24H29BrO9 |
| Molecular Weight | 541.39 g/mol |
| Exact Mass | 540.10 |
| IUPAC Name | methyl (1R,5S,6S,8R,9S,11S,12R,13R)-5,13-diacetyloxy-12-bromo-11-methyl-16-oxospiro[15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-6,2'-oxirane]-9-carboxylate |
| SMILES | COC(=O)C1C2[C@@]3(C[C@@H](OC(C)=O)[C@H](Br)[C@]2(C)C(=O)O3)C2CC[C@]3(OC(C)=O)C[C@]12C[C@]31CO1 |
| InChI | InChI=1S/C24H29BrO9/c1-11(26)32-13-7-24-14-5-6-22(33-12(2)27)8-21(14,9-23(22)10-31-23)15(18(28)30-4)16(24)20(3,17(13)25)19(29)34-24/h13-17H,5-10H2,1-4H3/t13-,14?,15?,16?,17+,20-,21-,22+,23+,24-/m1/s1 |
| InChIKey | HVDAWASGERJJRQ-JSIOOZESSA-N |
| XLogP | 2.07 |
| TPSA | 117.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|