C34H48O8Si — CID 11650217
methyl (1R,2R,5R,6S,8R,9S,10R,11S,12R)-12-acetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-16-oxo-11-(phenylmethoxymethyl)-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate (PubChem CID 11650217) has the molecular formula C34H48O8Si and a molecular weight of 612.84 g/mol. Its IUPAC name is methyl (1R,2R,5R,6S,8R,9S,10R,11S,12R)-12-acetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-16-oxo-11-(phenylmethoxymethyl)-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate.
| Compound Name | methyl (1R,2R,5R,6S,8R,9S,10R,11S,12R)-12-acetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-16-oxo-11-(phenylmethoxymethyl)-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate |
|---|---|
| PubChem CID | 11650217 |
| Molecular Formula | C34H48O8Si |
| Molecular Weight | 612.84 g/mol |
| Exact Mass | 612.31 |
| IUPAC Name | methyl (1R,2R,5R,6S,8R,9S,10R,11S,12R)-12-acetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-16-oxo-11-(phenylmethoxymethyl)-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H]2[C@@]3(CC[C@@H](OC(C)=O)[C@]2(COCc2ccccc2)C(=O)O3)[C@@H]2CC[C@@H]3C[C@@]21C[C@@H]3O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H48O8Si/c1-21(35)40-26-15-16-34-25-14-13-23-17-32(25,18-24(23)42-43(6,7)31(2,3)4)27(29(36)38-5)28(34)33(26,30(37)41-34)20-39-19-22-11-9-8-10-12-22/h8-12,23-28H,13-20H2,1-7H3/t23-,24+,25-,26-,27-,28-,32-,33+,34-/m1/s1 |
| InChIKey | TULBUEPWYXEPIH-GWFCYHPASA-N |
| XLogP | 5.83 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.84 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|