C32H46O7Si — CID 11678606
methyl (1R,2R,5R,6S,8R,9S,10R,11S,12R)-6-[tert-butyl(dimethyl)silyl]oxy-12-hydroxy-16-oxo-11-(phenylmethoxymethyl)-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate (PubChem CID 11678606) has the molecular formula C32H46O7Si and a molecular weight of 570.80 g/mol. Its IUPAC name is methyl (1R,2R,5R,6S,8R,9S,10R,11S,12R)-6-[tert-butyl(dimethyl)silyl]oxy-12-hydroxy-16-oxo-11-(phenylmethoxymethyl)-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate.
| Compound Name | methyl (1R,2R,5R,6S,8R,9S,10R,11S,12R)-6-[tert-butyl(dimethyl)silyl]oxy-12-hydroxy-16-oxo-11-(phenylmethoxymethyl)-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate |
|---|---|
| PubChem CID | 11678606 |
| Molecular Formula | C32H46O7Si |
| Molecular Weight | 570.80 g/mol |
| Exact Mass | 570.30 |
| IUPAC Name | methyl (1R,2R,5R,6S,8R,9S,10R,11S,12R)-6-[tert-butyl(dimethyl)silyl]oxy-12-hydroxy-16-oxo-11-(phenylmethoxymethyl)-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H]2[C@@]3(CC[C@@H](O)[C@]2(COCc2ccccc2)C(=O)O3)[C@@H]2CC[C@@H]3C[C@@]21C[C@@H]3O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H46O7Si/c1-29(2,3)40(5,6)39-22-17-30-16-21(22)12-13-23(30)32-15-14-24(33)31(28(35)38-32,26(32)25(30)27(34)36-4)19-37-18-20-10-8-7-9-11-20/h7-11,21-26,33H,12-19H2,1-6H3/t21-,22+,23-,24-,25-,26-,30-,31+,32-/m1/s1 |
| InChIKey | MIAMXVYOHTUFDD-SWDUWBMNSA-N |
| XLogP | 5.26 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.80 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|