C28H32O7Se — CID 10076470
methyl (1R,2R,5S,6S,8R,9S,10R,11S,12S)-12-acetyloxy-6,11-dimethyl-7,16-dioxo-5-phenylselanyl-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate (PubChem CID 10076470) has the molecular formula C28H32O7Se and a molecular weight of 559.52 g/mol. Its IUPAC name is methyl (1R,2R,5S,6S,8R,9S,10R,11S,12S)-12-acetyloxy-6,11-dimethyl-7,16-dioxo-5-phenylselanyl-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate.
| Compound Name | methyl (1R,2R,5S,6S,8R,9S,10R,11S,12S)-12-acetyloxy-6,11-dimethyl-7,16-dioxo-5-phenylselanyl-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate |
|---|---|
| PubChem CID | 10076470 |
| Molecular Formula | C28H32O7Se |
| Molecular Weight | 559.52 g/mol |
| Exact Mass | 560.13 |
| IUPAC Name | methyl (1R,2R,5S,6S,8R,9S,10R,11S,12S)-12-acetyloxy-6,11-dimethyl-7,16-dioxo-5-phenylselanyl-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H]2[C@@]3(CC[C@H](OC(C)=O)[C@@]2(C)C(=O)O3)[C@@H]2CC[C@]3([Se]c4ccccc4)C[C@]12C(=O)[C@@H]3C |
| InChI | InChI=1S/C28H32O7Se/c1-15-22(30)27-14-26(15,36-17-8-6-5-7-9-17)12-10-18(27)28-13-11-19(34-16(2)29)25(3,24(32)35-28)21(28)20(27)23(31)33-4/h5-9,15,18-21H,10-14H2,1-4H3/t15-,18+,19-,20+,21+,25+,26-,27+,28+/m0/s1 |
| InChIKey | CSKZKRJLKFCIQZ-RDMGDSNJSA-N |
| XLogP | 2.63 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|