C20H26F2O4 — CID 23234423
methyl (1R,5S,6S,8S,9S,11R,12R)-5,12-difluoro-6,11-dimethyl-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate (PubChem CID 23234423) has the molecular formula C20H26F2O4 and a molecular weight of 368.42 g/mol. Its IUPAC name is methyl (1R,5S,6S,8S,9S,11R,12R)-5,12-difluoro-6,11-dimethyl-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate.
| Compound Name | methyl (1R,5S,6S,8S,9S,11R,12R)-5,12-difluoro-6,11-dimethyl-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate |
|---|---|
| PubChem CID | 23234423 |
| Molecular Formula | C20H26F2O4 |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | methyl (1R,5S,6S,8S,9S,11R,12R)-5,12-difluoro-6,11-dimethyl-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate |
| SMILES | COC(=O)C1C2[C@@]3(CC[C@@H](F)[C@@]2(C)C(=O)O3)C2CC[C@]3(F)C[C@]12C[C@@H]3C |
| InChI | InChI=1S/C20H26F2O4/c1-10-8-18-9-19(10,22)6-4-11(18)20-7-5-12(21)17(2,16(24)26-20)14(20)13(18)15(23)25-3/h10-14H,4-9H2,1-3H3/t10-,11?,12+,13?,14?,17+,18-,19-,20+/m0/s1 |
| InChIKey | WSLXCSDNEANYHJ-YFMVPTJKSA-N |
| XLogP | 3.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |