C16H26O — CID 91747508
(2R,6S,8aR)-6-methoxy-8a-methyl-8-methylidene-2-propan-2-yl-1,2,3,4,6,7-hexahydronaphthalene (PubChem CID 91747508) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is (2R,6S,8aR)-6-methoxy-8a-methyl-8-methylidene-2-propan-2-yl-1,2,3,4,6,7-hexahydronaphthalene.
| Compound Name | (2R,6S,8aR)-6-methoxy-8a-methyl-8-methylidene-2-propan-2-yl-1,2,3,4,6,7-hexahydronaphthalene |
|---|---|
| PubChem CID | 91747508 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | (2R,6S,8aR)-6-methoxy-8a-methyl-8-methylidene-2-propan-2-yl-1,2,3,4,6,7-hexahydronaphthalene |
| SMILES | C=C1C[C@H](OC)C=C2CC[C@@H](C(C)C)C[C@]12C |
| InChI | InChI=1S/C16H26O/c1-11(2)13-6-7-14-9-15(17-5)8-12(3)16(14,4)10-13/h9,11,13,15H,3,6-8,10H2,1-2,4-5H3/t13-,15+,16-/m1/s1 |
| InChIKey | YBDXWBCELMMYLN-VNQPRFMTSA-N |
| XLogP | 4.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|