C24H19F14NO4 — CID 91748295
[1-[2,2,3,3,4,4,4-heptafluorobutanoyl(propan-2-yl)amino]-3-naphthalen-1-yloxypropan-2-yl] 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91748295) has the molecular formula C24H19F14NO4 and a molecular weight of 651.39 g/mol. Its IUPAC name is [1-[2,2,3,3,4,4,4-heptafluorobutanoyl(propan-2-yl)amino]-3-naphthalen-1-yloxypropan-2-yl] 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | [1-[2,2,3,3,4,4,4-heptafluorobutanoyl(propan-2-yl)amino]-3-naphthalen-1-yloxypropan-2-yl] 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91748295 |
| Molecular Formula | C24H19F14NO4 |
| Molecular Weight | 651.39 g/mol |
| Exact Mass | 651.11 |
| IUPAC Name | [1-[2,2,3,3,4,4,4-heptafluorobutanoyl(propan-2-yl)amino]-3-naphthalen-1-yloxypropan-2-yl] 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | CC(C)N(CC(COc1cccc2ccccc12)OC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H19F14NO4/c1-12(2)39(17(40)19(25,26)21(29,30)23(33,34)35)10-14(43-18(41)20(27,28)22(31,32)24(36,37)38)11-42-16-9-5-7-13-6-3-4-8-15(13)16/h3-9,12,14H,10-11H2,1-2H3 |
| InChIKey | XBHHNHGLKOIVNW-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.39 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|