C27H28F12O10 — CID 91749412
[(2S,3S,4R,5S,6S)-3,4,5-tris[(2,2,2-trifluoroacetyl)oxy]-6-[(E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-yl]oxyoxan-2-yl]methyl 2,2,2-trifluoroacetate (PubChem CID 91749412) has the molecular formula C27H28F12O10 and a molecular weight of 740.49 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6S)-3,4,5-tris[(2,2,2-trifluoroacetyl)oxy]-6-[(E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-yl]oxyoxan-2-yl]methyl 2,2,2-trifluoroacetate.
| Compound Name | [(2S,3S,4R,5S,6S)-3,4,5-tris[(2,2,2-trifluoroacetyl)oxy]-6-[(E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-yl]oxyoxan-2-yl]methyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91749412 |
| Molecular Formula | C27H28F12O10 |
| Molecular Weight | 740.49 g/mol |
| Exact Mass | 740.15 |
| IUPAC Name | [(2S,3S,4R,5S,6S)-3,4,5-tris[(2,2,2-trifluoroacetyl)oxy]-6-[(E)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-yl]oxyoxan-2-yl]methyl 2,2,2-trifluoroacetate |
| SMILES | CC1=CCCC(C)(C)C1/C=C/C(C)O[C@H]1O[C@@H](COC(=O)C(F)(F)F)[C@H](OC(=O)C(F)(F)F)[C@@H](OC(=O)C(F)(F)F)[C@@H]1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C27H28F12O10/c1-11-6-5-9-23(3,4)13(11)8-7-12(2)45-18-17(49-22(43)27(37,38)39)16(48-21(42)26(34,35)36)15(47-20(41)25(31,32)33)14(46-18)10-44-19(40)24(28,29)30/h6-8,12-18H,5,9-10H2,1-4H3/b8-7+/t12?,13?,14-,15-,16+,17-,18-/m0/s1 |
| InChIKey | NGUMVGJAUDODIR-MEXKKBNTSA-N |
| XLogP | 5.58 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.49 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|