C13H23NO3 — CID 91749455
[(1S,7R)-7-hydroxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl 2-methylbutanoate (PubChem CID 91749455) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is [(1S,7R)-7-hydroxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl 2-methylbutanoate.
| Compound Name | [(1S,7R)-7-hydroxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl 2-methylbutanoate |
|---|---|
| PubChem CID | 91749455 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | [(1S,7R)-7-hydroxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC[C@H]1CCN2CC[C@@H](O)C12 |
| InChI | InChI=1S/C13H23NO3/c1-3-9(2)13(16)17-8-10-4-6-14-7-5-11(15)12(10)14/h9-12,15H,3-8H2,1-2H3/t9?,10-,11-,12?/m1/s1 |
| InChIKey | JDZNNMHSMYUKBP-BFUDSRACSA-N |
| XLogP | 1.03 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |