C32H56O2Si — CID 91749462
[(2R,5S,7R,9S,15R,16R)-15-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl]oxy-trimethylsilane (PubChem CID 91749462) has the molecular formula C32H56O2Si and a molecular weight of 500.88 g/mol. Its IUPAC name is [(2R,5S,7R,9S,15R,16R)-15-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl]oxy-trimethylsilane.
| Compound Name | [(2R,5S,7R,9S,15R,16R)-15-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 91749462 |
| Molecular Formula | C32H56O2Si |
| Molecular Weight | 500.88 g/mol |
| Exact Mass | 500.40 |
| IUPAC Name | [(2R,5S,7R,9S,15R,16R)-15-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl]oxy-trimethylsilane |
| SMILES | CC[C@H](/C=C/[C@@H](C)[C@H]1CCC2C3C[C@@H]4O[C@@]45C[C@@H](O[Si](C)(C)C)CC[C@]5(C)C3CC[C@@]21C)C(C)C |
| InChI | InChI=1S/C32H56O2Si/c1-10-23(21(2)3)12-11-22(4)26-13-14-27-25-19-29-32(33-29)20-24(34-35(7,8)9)15-18-31(32,6)28(25)16-17-30(26,27)5/h11-12,21-29H,10,13-20H2,1-9H3/b12-11+/t22-,23-,24+,25?,26-,27?,28?,29+,30-,31-,32+/m1/s1 |
| InChIKey | CBLBSCDLFZTIRL-JDZZQNPKSA-N |
| XLogP | 8.87 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.88 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|