C23H52O7Si4 — CID 91752376
trimethylsilyl 6-(3-methylbutoxy)-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate (PubChem CID 91752376) has the molecular formula C23H52O7Si4 and a molecular weight of 553.01 g/mol. Its IUPAC name is trimethylsilyl 6-(3-methylbutoxy)-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate.
| Compound Name | trimethylsilyl 6-(3-methylbutoxy)-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 91752376 |
| Molecular Formula | C23H52O7Si4 |
| Molecular Weight | 553.01 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | trimethylsilyl 6-(3-methylbutoxy)-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate |
| SMILES | CC(C)CCOC1OC(C(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C23H52O7Si4/c1-17(2)15-16-25-23-21(29-33(9,10)11)19(28-32(6,7)8)18(27-31(3,4)5)20(26-23)22(24)30-34(12,13)14/h17-21,23H,15-16H2,1-14H3 |
| InChIKey | AVXTWRBCNSBVSC-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.01 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|