About [tert-butyl(dimethyl)silyl] 2-hydroxyoctanoate
[tert-butyl(dimethyl)silyl] 2-hydroxyoctanoate (PubChem CID 91752569) has the molecular formula C14H30O3Si
and a molecular weight of 274.48 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2-hydroxyoctanoate.
Molecular Properties
| Compound Name | [tert-butyl(dimethyl)silyl] 2-hydroxyoctanoate |
| PubChem CID | 91752569 |
| Molecular Formula | C14H30O3Si |
| Molecular Weight | 274.48 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2-hydroxyoctanoate |
| SMILES | CCCCCCC(O)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30O3Si/c1-7-8-9-10-11-12(15)13(16)17-18(5,6)14(2,3)4/h12,15H,7-11H2,1-6H3 |
| InChIKey | UYMDSEGXUSBUIQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [tert-butyl(dimethyl)silyl] 2-hydroxyoctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [tert-butyl(dimethyl)silyl] 2-hydroxyoctanoate?
The IUPAC name of [tert-butyl(dimethyl)silyl] 2-hydroxyoctanoate (CID 91752569) is [tert-butyl(dimethyl)silyl] 2-hydroxyoctanoate.
What is the SMILES notation for [tert-butyl(dimethyl)silyl] 2-hydroxyoctanoate?
The canonical SMILES for [tert-butyl(dimethyl)silyl] 2-hydroxyoctanoate is CCCCCCC(O)C(=O)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of [tert-butyl(dimethyl)silyl] 2-hydroxyoctanoate?
The InChIKey is UYMDSEGXUSBUIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O3Si/c1-7-8-9-10-11-12(15)13(16)17-18(5,6)14(2,3)4/h12,15H,7-11H2,1-6H3.
What are the key properties of [tert-butyl(dimethyl)silyl] 2-hydroxyoctanoate?
[tert-butyl(dimethyl)silyl] 2-hydroxyoctanoate has a molecular weight of 274.48 g/mol, XLogP of 3.87, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [tert-butyl(dimethyl)silyl] 2-hydroxyoctanoate is sourced from PubChem (CID 91752569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).