About [tert-butyl(dimethyl)silyl] 3-hydroxydecanoate
[tert-butyl(dimethyl)silyl] 3-hydroxydecanoate (PubChem CID 91752588) has the molecular formula C16H34O3Si
and a molecular weight of 302.53 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 3-hydroxydecanoate.
Molecular Properties
| Compound Name | [tert-butyl(dimethyl)silyl] 3-hydroxydecanoate |
| PubChem CID | 91752588 |
| Molecular Formula | C16H34O3Si |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.23 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 3-hydroxydecanoate |
| SMILES | CCCCCCCC(O)CC(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H34O3Si/c1-7-8-9-10-11-12-14(17)13-15(18)19-20(5,6)16(2,3)4/h14,17H,7-13H2,1-6H3 |
| InChIKey | JOYUERVIGPNIEX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [tert-butyl(dimethyl)silyl] 3-hydroxydecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [tert-butyl(dimethyl)silyl] 3-hydroxydecanoate?
The IUPAC name of [tert-butyl(dimethyl)silyl] 3-hydroxydecanoate (CID 91752588) is [tert-butyl(dimethyl)silyl] 3-hydroxydecanoate.
What is the SMILES notation for [tert-butyl(dimethyl)silyl] 3-hydroxydecanoate?
The canonical SMILES for [tert-butyl(dimethyl)silyl] 3-hydroxydecanoate is CCCCCCCC(O)CC(=O)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of [tert-butyl(dimethyl)silyl] 3-hydroxydecanoate?
The InChIKey is JOYUERVIGPNIEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O3Si/c1-7-8-9-10-11-12-14(17)13-15(18)19-20(5,6)16(2,3)4/h14,17H,7-13H2,1-6H3.
What are the key properties of [tert-butyl(dimethyl)silyl] 3-hydroxydecanoate?
[tert-butyl(dimethyl)silyl] 3-hydroxydecanoate has a molecular weight of 302.53 g/mol, XLogP of 4.65, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [tert-butyl(dimethyl)silyl] 3-hydroxydecanoate is sourced from PubChem (CID 91752588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).