C15H13BrO4 — CID 91752679
(3aS,4S,6aS)-4-[2-(3-bromophenyl)ethyl]-3-methylidene-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione (PubChem CID 91752679) has the molecular formula C15H13BrO4 and a molecular weight of 337.17 g/mol. Its IUPAC name is (3aS,4S,6aS)-4-[2-(3-bromophenyl)ethyl]-3-methylidene-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione.
| Compound Name | (3aS,4S,6aS)-4-[2-(3-bromophenyl)ethyl]-3-methylidene-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione |
|---|---|
| PubChem CID | 91752679 |
| Molecular Formula | C15H13BrO4 |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | (3aS,4S,6aS)-4-[2-(3-bromophenyl)ethyl]-3-methylidene-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione |
| SMILES | C=C1C(=O)O[C@@H]2C(=O)O[C@@H](CCc3cccc(Br)c3)[C@H]12 |
| InChI | InChI=1S/C15H13BrO4/c1-8-12-11(19-15(18)13(12)20-14(8)17)6-5-9-3-2-4-10(16)7-9/h2-4,7,11-13H,1,5-6H2/t11-,12-,13-/m0/s1 |
| InChIKey | PQPPZWZZPBSQJW-AVGNSLFASA-N |
| XLogP | 2.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|