C13H22N4O3 — CID 917557
N,3-ditert-butyl-1-methyl-4-nitropyrazole-5-carboxamide (PubChem CID 917557) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is N,3-ditert-butyl-1-methyl-4-nitropyrazole-5-carboxamide.
| Compound Name | N,3-ditert-butyl-1-methyl-4-nitropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 917557 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | N,3-ditert-butyl-1-methyl-4-nitropyrazole-5-carboxamide |
| SMILES | Cn1nc(C(C)(C)C)c([N+](=O)[O-])c1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C13H22N4O3/c1-12(2,3)10-8(17(19)20)9(16(7)15-10)11(18)14-13(4,5)6/h1-7H3,(H,14,18) |
| InChIKey | SUXQEAVAXNVPSH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|