C13H22N4O3 — CID 918936
3-tert-butyl-N,N-diethyl-1-methyl-4-nitropyrazole-5-carboxamide (PubChem CID 918936) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 3-tert-butyl-N,N-diethyl-1-methyl-4-nitropyrazole-5-carboxamide.
| Compound Name | 3-tert-butyl-N,N-diethyl-1-methyl-4-nitropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 918936 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 3-tert-butyl-N,N-diethyl-1-methyl-4-nitropyrazole-5-carboxamide |
| SMILES | CCN(CC)C(=O)c1c([N+](=O)[O-])c(C(C)(C)C)nn1C |
| InChI | InChI=1S/C13H22N4O3/c1-7-16(8-2)12(18)10-9(17(19)20)11(13(3,4)5)14-15(10)6/h7-8H2,1-6H3 |
| InChIKey | VPNMHVIMKLMAFD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|