C28H22FNPS+ — CID 91757228
[2-(2-fluorophenyl)-1,3-thiazol-4-yl]methyl-triphenylphosphanium (PubChem CID 91757228) has the molecular formula C28H22FNPS+ and a molecular weight of 454.53 g/mol. Its IUPAC name is [2-(2-fluorophenyl)-1,3-thiazol-4-yl]methyl-triphenylphosphanium.
| Compound Name | [2-(2-fluorophenyl)-1,3-thiazol-4-yl]methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 91757228 |
| Molecular Formula | C28H22FNPS+ |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | [2-(2-fluorophenyl)-1,3-thiazol-4-yl]methyl-triphenylphosphanium |
| SMILES | Fc1ccccc1-c1nc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cs1 |
| InChI | InChI=1S/C28H22FNPS/c29-27-19-11-10-18-26(27)28-30-22(21-32-28)20-31(23-12-4-1-5-13-23,24-14-6-2-7-15-24)25-16-8-3-9-17-25/h1-19,21H,20H2/q+1 |
| InChIKey | YASWYXHAGGCPIE-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|