C28H24IN2PS2 — CID 11548963
triphenyl-[[2-(2-prop-1-en-2-yl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]methyl]phosphanium iodide (PubChem CID 11548963) has the molecular formula C28H24IN2PS2 and a molecular weight of 610.53 g/mol. Its IUPAC name is triphenyl-[[2-(2-prop-1-en-2-yl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]methyl]phosphanium iodide.
| Compound Name | triphenyl-[[2-(2-prop-1-en-2-yl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]methyl]phosphanium iodide |
|---|---|
| PubChem CID | 11548963 |
| Molecular Formula | C28H24IN2PS2 |
| Molecular Weight | 610.53 g/mol |
| Exact Mass | 610.02 |
| IUPAC Name | triphenyl-[[2-(2-prop-1-en-2-yl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]methyl]phosphanium iodide |
| SMILES | C=C(C)c1nc(-c2nc(C[P+](c3ccccc3)(c3ccccc3)c3ccccc3)cs2)cs1.[I-] |
| InChI | InChI=1S/C28H24N2PS2.HI/c1-21(2)27-30-26(20-33-27)28-29-22(19-32-28)18-31(23-12-6-3-7-13-23,24-14-8-4-9-15-24)25-16-10-5-11-17-25;/h3-17,19-20H,1,18H2,2H3;1H/q+1;/p-1 |
| InChIKey | VNHYVFBDTGBEDG-UHFFFAOYSA-M |
| XLogP | 3.80 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|