C20H22N2O2S — CID 91761200
N-(furan-2-ylmethyl)-N-[[5-(oxolan-2-yl)thiophen-2-yl]methyl]-1-pyridin-4-ylmethanamine (PubChem CID 91761200) has the molecular formula C20H22N2O2S and a molecular weight of 354.47 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-[[5-(oxolan-2-yl)thiophen-2-yl]methyl]-1-pyridin-4-ylmethanamine.
| Compound Name | N-(furan-2-ylmethyl)-N-[[5-(oxolan-2-yl)thiophen-2-yl]methyl]-1-pyridin-4-ylmethanamine |
|---|---|
| PubChem CID | 91761200 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-[[5-(oxolan-2-yl)thiophen-2-yl]methyl]-1-pyridin-4-ylmethanamine |
| SMILES | c1coc(CN(Cc2ccncc2)Cc2ccc(C3CCCO3)s2)c1 |
| InChI | InChI=1S/C20H22N2O2S/c1-3-17(23-11-1)14-22(13-16-7-9-21-10-8-16)15-18-5-6-20(25-18)19-4-2-12-24-19/h1,3,5-11,19H,2,4,12-15H2 |
| InChIKey | UAYSDOCWGZYUKS-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |