C12H16N6OS — CID 91764335
3-[6-[2-(2H-triazol-4-ylsulfanyl)ethylamino]pyrimidin-4-yl]cyclobutan-1-ol (PubChem CID 91764335) has the molecular formula C12H16N6OS and a molecular weight of 292.37 g/mol. Its IUPAC name is 3-[6-[2-(2H-triazol-4-ylsulfanyl)ethylamino]pyrimidin-4-yl]cyclobutan-1-ol.
| Compound Name | 3-[6-[2-(2H-triazol-4-ylsulfanyl)ethylamino]pyrimidin-4-yl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 91764335 |
| Molecular Formula | C12H16N6OS |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 3-[6-[2-(2H-triazol-4-ylsulfanyl)ethylamino]pyrimidin-4-yl]cyclobutan-1-ol |
| SMILES | OC1CC(c2cc(NCCSc3cn[nH]n3)ncn2)C1 |
| InChI | InChI=1S/C12H16N6OS/c19-9-3-8(4-9)10-5-11(15-7-14-10)13-1-2-20-12-6-16-18-17-12/h5-9,19H,1-4H2,(H,13,14,15)(H,16,17,18) |
| InChIKey | AQGSRBJNZXYZFI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|