C17H20N4O2 — CID 9176903
N-[[(2S,6S)-2,6-dimethylcyclohexylidene]amino]-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 9176903) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is N-[[(2S,6S)-2,6-dimethylcyclohexylidene]amino]-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-[[(2S,6S)-2,6-dimethylcyclohexylidene]amino]-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 9176903 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N-[[(2S,6S)-2,6-dimethylcyclohexylidene]amino]-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | C[C@H]1CCC[C@H](C)C1=NNC(=O)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C17H20N4O2/c1-10-6-5-7-11(2)14(10)18-21-17(23)15-12-8-3-4-9-13(12)16(22)20-19-15/h3-4,8-11H,5-7H2,1-2H3,(H,20,22)(H,21,23)/t10-,11-/m0/s1 |
| InChIKey | IOMIIIXQWVIIOL-QWRGUYRKSA-N |
| XLogP | 2.46 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|