C17H12Cl2N4O2S — CID 166219668
N-[(E)-(1,3-dichloro-6,7-dihydro-5H-2-benzothiophen-4-ylidene)amino]-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 166219668) has the molecular formula C17H12Cl2N4O2S and a molecular weight of 407.28 g/mol. Its IUPAC name is N-[(E)-(1,3-dichloro-6,7-dihydro-5H-2-benzothiophen-4-ylidene)amino]-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-[(E)-(1,3-dichloro-6,7-dihydro-5H-2-benzothiophen-4-ylidene)amino]-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 166219668 |
| Molecular Formula | C17H12Cl2N4O2S |
| Molecular Weight | 407.28 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | N-[(E)-(1,3-dichloro-6,7-dihydro-5H-2-benzothiophen-4-ylidene)amino]-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | O=C(N/N=C1\CCCc2c(Cl)sc(Cl)c21)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C17H12Cl2N4O2S/c18-14-10-6-3-7-11(12(10)15(19)26-14)20-23-17(25)13-8-4-1-2-5-9(8)16(24)22-21-13/h1-2,4-5H,3,6-7H2,(H,22,24)(H,23,25)/b20-11+ |
| InChIKey | QIPWLZCPFXUKPY-RGVLZGJSSA-N |
| XLogP | 3.76 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|