C19H15ClN4O4 — CID 8785036
N-[(Z)-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylideneamino]-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 8785036) has the molecular formula C19H15ClN4O4 and a molecular weight of 398.81 g/mol. Its IUPAC name is N-[(Z)-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylideneamino]-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-[(Z)-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylideneamino]-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 8785036 |
| Molecular Formula | C19H15ClN4O4 |
| Molecular Weight | 398.81 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | N-[(Z)-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylideneamino]-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | O=C(N/N=C\c1cc(Cl)c2c(c1)OCCCO2)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C19H15ClN4O4/c20-14-8-11(9-15-17(14)28-7-3-6-27-15)10-21-23-19(26)16-12-4-1-2-5-13(12)18(25)24-22-16/h1-2,4-5,8-10H,3,6-7H2,(H,23,26)(H,24,25)/b21-10- |
| InChIKey | RLBAVEZQTONNIF-FBHDLOMBSA-N |
| XLogP | 2.50 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.81 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|