C20H29NO4 — CID 91771255
N-[(3S,4R)-3-[4-(hydroxymethyl)phenoxy]oxan-4-yl]cycloheptanecarboxamide (PubChem CID 91771255) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is N-[(3S,4R)-3-[4-(hydroxymethyl)phenoxy]oxan-4-yl]cycloheptanecarboxamide.
| Compound Name | N-[(3S,4R)-3-[4-(hydroxymethyl)phenoxy]oxan-4-yl]cycloheptanecarboxamide |
|---|---|
| PubChem CID | 91771255 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | N-[(3S,4R)-3-[4-(hydroxymethyl)phenoxy]oxan-4-yl]cycloheptanecarboxamide |
| SMILES | O=C(N[C@@H]1CCOC[C@H]1Oc1ccc(CO)cc1)C1CCCCCC1 |
| InChI | InChI=1S/C20H29NO4/c22-13-15-7-9-17(10-8-15)25-19-14-24-12-11-18(19)21-20(23)16-5-3-1-2-4-6-16/h7-10,16,18-19,22H,1-6,11-14H2,(H,21,23)/t18-,19-/m1/s1 |
| InChIKey | CPKQURJLYMOKGE-RTBURBONSA-N |
| XLogP | 2.80 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |