C19H26N2O4 — CID 91771131
4-[(3S,4R)-4-[(2-cyclopentylacetyl)amino]oxan-3-yl]oxybenzamide (PubChem CID 91771131) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 4-[(3S,4R)-4-[(2-cyclopentylacetyl)amino]oxan-3-yl]oxybenzamide.
| Compound Name | 4-[(3S,4R)-4-[(2-cyclopentylacetyl)amino]oxan-3-yl]oxybenzamide |
|---|---|
| PubChem CID | 91771131 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 4-[(3S,4R)-4-[(2-cyclopentylacetyl)amino]oxan-3-yl]oxybenzamide |
| SMILES | NC(=O)c1ccc(O[C@@H]2COCC[C@H]2NC(=O)CC2CCCC2)cc1 |
| InChI | InChI=1S/C19H26N2O4/c20-19(23)14-5-7-15(8-6-14)25-17-12-24-10-9-16(17)21-18(22)11-13-3-1-2-4-13/h5-8,13,16-17H,1-4,9-12H2,(H2,20,23)(H,21,22)/t16-,17-/m1/s1 |
| InChIKey | ZUIQHQVSLKTMDB-IAGOWNOFSA-N |
| XLogP | 2.02 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |