C17H23N3O5 — CID 91780513
N'-[(3S,4R)-3-(4-carbamoylphenoxy)oxan-4-yl]-N-methylbutanediamide (PubChem CID 91780513) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is N'-[(3S,4R)-3-(4-carbamoylphenoxy)oxan-4-yl]-N-methylbutanediamide.
| Compound Name | N'-[(3S,4R)-3-(4-carbamoylphenoxy)oxan-4-yl]-N-methylbutanediamide |
|---|---|
| PubChem CID | 91780513 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | N'-[(3S,4R)-3-(4-carbamoylphenoxy)oxan-4-yl]-N-methylbutanediamide |
| SMILES | CNC(=O)CCC(=O)N[C@@H]1CCOC[C@H]1Oc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C17H23N3O5/c1-19-15(21)6-7-16(22)20-13-8-9-24-10-14(13)25-12-4-2-11(3-5-12)17(18)23/h2-5,13-14H,6-10H2,1H3,(H2,18,23)(H,19,21)(H,20,22)/t13-,14-/m1/s1 |
| InChIKey | LVDKYDYZJJIASG-ZIAGYGMSSA-N |
| XLogP | -0.04 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |