C18H21N3O4 — CID 91789429
N-[(3S,4R)-3-(4-carbamoylphenoxy)oxan-4-yl]-2-methyl-1H-pyrrole-3-carboxamide (PubChem CID 91789429) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is N-[(3S,4R)-3-(4-carbamoylphenoxy)oxan-4-yl]-2-methyl-1H-pyrrole-3-carboxamide.
| Compound Name | N-[(3S,4R)-3-(4-carbamoylphenoxy)oxan-4-yl]-2-methyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 91789429 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N-[(3S,4R)-3-(4-carbamoylphenoxy)oxan-4-yl]-2-methyl-1H-pyrrole-3-carboxamide |
| SMILES | Cc1[nH]ccc1C(=O)N[C@@H]1CCOC[C@H]1Oc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C18H21N3O4/c1-11-14(6-8-20-11)18(23)21-15-7-9-24-10-16(15)25-13-4-2-12(3-5-13)17(19)22/h2-6,8,15-16,20H,7,9-10H2,1H3,(H2,19,22)(H,21,23)/t15-,16-/m1/s1 |
| InChIKey | ISVNDOFOZDCRMV-HZPDHXFCSA-N |
| XLogP | 1.39 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |