C16H22N2O4S — CID 91797995
4-[(3S,4R)-4-(3-methylsulfanylpropanoylamino)oxan-3-yl]oxybenzamide (PubChem CID 91797995) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is 4-[(3S,4R)-4-(3-methylsulfanylpropanoylamino)oxan-3-yl]oxybenzamide.
| Compound Name | 4-[(3S,4R)-4-(3-methylsulfanylpropanoylamino)oxan-3-yl]oxybenzamide |
|---|---|
| PubChem CID | 91797995 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 4-[(3S,4R)-4-(3-methylsulfanylpropanoylamino)oxan-3-yl]oxybenzamide |
| SMILES | CSCCC(=O)N[C@@H]1CCOC[C@H]1Oc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C16H22N2O4S/c1-23-9-7-15(19)18-13-6-8-21-10-14(13)22-12-4-2-11(3-5-12)16(17)20/h2-5,13-14H,6-10H2,1H3,(H2,17,20)(H,18,19)/t13-,14-/m1/s1 |
| InChIKey | CFMRQHIOCHQXHJ-ZIAGYGMSSA-N |
| XLogP | 1.19 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |